C26H23N5O2S — CID 135650337
(NE,1Z)-3-carbazol-9-yl-N-[[4-(3-ethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylidene]propanehydrazonate (PubChem CID 135650337) has the molecular formula C26H23N5O2S and a molecular weight of 469.57 g/mol. Its IUPAC name is (NE,1Z)-3-carbazol-9-yl-N-[[4-(3-ethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylidene]propanehydrazonate.
| Compound Name | (NE,1Z)-3-carbazol-9-yl-N-[[4-(3-ethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylidene]propanehydrazonate |
|---|---|
| PubChem CID | 135650337 |
| Molecular Formula | C26H23N5O2S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | (NE,1Z)-3-carbazol-9-yl-N-[[4-(3-ethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylidene]propanehydrazonate |
| SMILES | CCc1ccc[n+](-c2[nH]c(=O)sc2/C=N/N=C(\[O-])CCn2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C26H23N5O2S/c1-2-18-8-7-14-30(17-18)25-23(34-26(33)28-25)16-27-29-24(32)13-15-31-21-11-5-3-9-19(21)20-10-4-6-12-22(20)31/h3-12,14,16-17H,2,13,15H2,1H3,(H-,27,28,29,32,33) |
| InChIKey | CTOPDRKAONZSSR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|