C17H15N4O2S+ — CID 135904230
N-[(Z)-[4-(3-methylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]benzamide (PubChem CID 135904230) has the molecular formula C17H15N4O2S+ and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[(Z)-[4-(3-methylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]benzamide.
| Compound Name | N-[(Z)-[4-(3-methylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 135904230 |
| Molecular Formula | C17H15N4O2S+ |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-[(Z)-[4-(3-methylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]benzamide |
| SMILES | Cc1ccc[n+](-c2[nH]c(=O)sc2/C=N\NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H14N4O2S/c1-12-6-5-9-21(11-12)15-14(24-17(23)19-15)10-18-20-16(22)13-7-3-2-4-8-13/h2-11H,1H3,(H-,18,19,20,22,23)/p+1 |
| InChIKey | HUFUENGPOQOSBS-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 78.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|