C19H14N5O2S+ — CID 135858390
N-[(E)-(4-isoquinolin-2-ium-2-yl-2-oxo-3H-1,3-thiazol-5-yl)methylideneamino]pyridine-4-carboxamide (PubChem CID 135858390) has the molecular formula C19H14N5O2S+ and a molecular weight of 376.42 g/mol. Its IUPAC name is N-[(E)-(4-isoquinolin-2-ium-2-yl-2-oxo-3H-1,3-thiazol-5-yl)methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-(4-isoquinolin-2-ium-2-yl-2-oxo-3H-1,3-thiazol-5-yl)methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135858390 |
| Molecular Formula | C19H14N5O2S+ |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-[(E)-(4-isoquinolin-2-ium-2-yl-2-oxo-3H-1,3-thiazol-5-yl)methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C/c1sc(=O)[nH]c1-[n+]1ccc2ccccc2c1)c1ccncc1 |
| InChI | InChI=1S/C19H13N5O2S/c25-18(14-5-8-20-9-6-14)23-21-11-16-17(22-19(26)27-16)24-10-7-13-3-1-2-4-15(13)12-24/h1-12H,(H-,20,21,22,23,25,26)/p+1 |
| InChIKey | VGAYLUPOYYKOKX-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|