C17H15N5OS2 — CID 135951014
N-[(Z)-[4-(4-methylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]-N'-phenylcarbamimidothioate (PubChem CID 135951014) has the molecular formula C17H15N5OS2 and a molecular weight of 369.48 g/mol. Its IUPAC name is N-[(Z)-[4-(4-methylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]-N'-phenylcarbamimidothioate.
| Compound Name | N-[(Z)-[4-(4-methylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]-N'-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 135951014 |
| Molecular Formula | C17H15N5OS2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | N-[(Z)-[4-(4-methylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]-N'-phenylcarbamimidothioate |
| SMILES | Cc1cc[n+](-c2[nH]c(=O)sc2/C=N\N/C([S-])=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C17H15N5OS2/c1-12-7-9-22(10-8-12)15-14(25-17(23)20-15)11-18-21-16(24)19-13-5-3-2-4-6-13/h2-11H,1H3,(H2-,18,19,20,21,23,24) |
| InChIKey | UJFZFQBBZUDIIV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|