C32H26N3NiOPS — CID 71465777
nickel(2+);N-[(E)-(2-oxidophenyl)methylideneamino]-N'-phenylcarbamimidothioate;triphenylphosphane (PubChem CID 71465777) has the molecular formula C32H26N3NiOPS and a molecular weight of 590.31 g/mol. Its IUPAC name is nickel(2+);N-[(E)-(2-oxidophenyl)methylideneamino]-N'-phenylcarbamimidothioate;triphenylphosphane.
| Compound Name | nickel(2+);N-[(E)-(2-oxidophenyl)methylideneamino]-N'-phenylcarbamimidothioate;triphenylphosphane |
|---|---|
| PubChem CID | 71465777 |
| Molecular Formula | C32H26N3NiOPS |
| Molecular Weight | 590.31 g/mol |
| Exact Mass | 589.09 |
| IUPAC Name | nickel(2+);N-[(E)-(2-oxidophenyl)methylideneamino]-N'-phenylcarbamimidothioate;triphenylphosphane |
| SMILES | [Ni+2].[O-]c1ccccc1/C=N/N/C([S-])=N/c1ccccc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C14H13N3OS.Ni/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;18-13-9-5-4-6-11(13)10-15-17-14(19)16-12-7-2-1-3-8-12;/h1-15H;1-10,18H,(H2,16,17,19);/q;;+2/p-2/b;15-10+; |
| InChIKey | HMOBKSQPAPUFKP-OYEVQUPYSA-L |
| XLogP | 5.36 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.31 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|