C11H12NO3- — CID 132595752
2-(2-carboxypropan-2-yliminomethyl)phenolate (PubChem CID 132595752) has the molecular formula C11H12NO3- and a molecular weight of 206.22 g/mol. Its IUPAC name is 2-(2-carboxypropan-2-yliminomethyl)phenolate.
| Compound Name | 2-(2-carboxypropan-2-yliminomethyl)phenolate |
|---|---|
| PubChem CID | 132595752 |
| Molecular Formula | C11H12NO3- |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-(2-carboxypropan-2-yliminomethyl)phenolate |
| SMILES | CC(C)(/N=C/c1ccccc1[O-])C(=O)O |
| InChI | InChI=1S/C11H13NO3/c1-11(2,10(14)15)12-7-8-5-3-4-6-9(8)13/h3-7,13H,1-2H3,(H,14,15)/p-1/b12-7+ |
| InChIKey | XJJPTSZKUXLUKQ-KPKJPENVSA-M |
| XLogP | 1.04 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|