C10H9ClKNO4Pt — CID 57341342
potassium;chloroplatinum(1+);(2S)-3-hydroxy-2-[(2-oxidophenyl)methylideneamino]propanoate (PubChem CID 57341342) has the molecular formula C10H9ClKNO4Pt and a molecular weight of 476.81 g/mol. Its IUPAC name is potassium;chloroplatinum(1+);(2S)-3-hydroxy-2-[(2-oxidophenyl)methylideneamino]propanoate.
| Compound Name | potassium;chloroplatinum(1+);(2S)-3-hydroxy-2-[(2-oxidophenyl)methylideneamino]propanoate |
|---|---|
| PubChem CID | 57341342 |
| Molecular Formula | C10H9ClKNO4Pt |
| Molecular Weight | 476.81 g/mol |
| Exact Mass | 475.95 |
| IUPAC Name | potassium;chloroplatinum(1+);(2S)-3-hydroxy-2-[(2-oxidophenyl)methylideneamino]propanoate |
| SMILES | Cl[Pt+].O=C([O-])[C@H](CO)/N=C/c1ccccc1[O-].[K+] |
| InChI | InChI=1S/C10H11NO4.ClH.K.Pt/c12-6-8(10(14)15)11-5-7-3-1-2-4-9(7)13;;;/h1-5,8,12-13H,6H2,(H,14,15);1H;;/q;;+1;+2/p-3/b11-5+;;;/t8-;;;/m0.../s1 |
| InChIKey | CDBVRRTXUIVWAH-QMGWQCRISA-K |
| XLogP | -4.02 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.81 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|