C12H12K2N2O4 — CID 100950236
CID 100950236 (PubChem CID 100950236) has the molecular formula C12H12K2N2O4 and a molecular weight of 326.43 g/mol.
| Compound Name | CID 100950236 |
|---|---|
| PubChem CID | 100950236 |
| Molecular Formula | C12H12K2N2O4 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | — |
| SMILES | C[C](NC(=O)C/N=C/c1ccccc1[O-])C(=O)O.[K+].[K] |
| InChI | InChI=1S/C12H13N2O4.2K/c1-8(12(17)18)14-11(16)7-13-6-9-4-2-3-5-10(9)15;;/h2-6,15H,7H2,1H3,(H,14,16)(H,17,18);;/q;;+1/p-1/b13-6+;; |
| InChIKey | JQDZYTUTQVAXQF-JNXPPIHMSA-M |
| XLogP | -3.45 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|