C15H15N5O3Zn — CID 139063984
zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate (PubChem CID 139063984) has the molecular formula C15H15N5O3Zn and a molecular weight of 378.71 g/mol. Its IUPAC name is zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate.
| Compound Name | zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate |
|---|---|
| PubChem CID | 139063984 |
| Molecular Formula | C15H15N5O3Zn |
| Molecular Weight | 378.71 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate |
| SMILES | O=C([O-])C/N=C/c1ccccc1[O-].[Zn+2].c1c[nH]cn1.c1c[nH]cn1 |
| InChI | InChI=1S/C9H9NO3.2C3H4N2.Zn/c11-8-4-2-1-3-7(8)5-10-6-9(12)13;2*1-2-5-3-4-1;/h1-5,11H,6H2,(H,12,13);2*1-3H,(H,4,5);/q;;;+2/p-2/b10-5+;;; |
| InChIKey | LGWNYSIMZYQGOI-RWWJYAHQSA-L |
| XLogP | -0.25 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.71 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|