About zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate
zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate (PubChem CID 139063984) has the molecular formula C15H15N5O3Zn
and a molecular weight of 378.71 g/mol. Its IUPAC name is zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate.
Molecular Properties
| Compound Name | zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate |
| PubChem CID | 139063984 |
| Molecular Formula | C15H15N5O3Zn |
| Molecular Weight | 378.71 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate |
| SMILES | O=C([O-])C/N=C/c1ccccc1[O-].[Zn+2].c1c[nH]cn1.c1c[nH]cn1 |
| InChI | InChI=1S/C9H9NO3.2C3H4N2.Zn/c11-8-4-2-1-3-7(8)5-10-6-9(12)13;2*1-2-5-3-4-1;/h1-5,11H,6H2,(H,12,13);2*1-3H,(H,4,5);/q;;;+2/p-2/b10-5+;;; |
| InChIKey | LGWNYSIMZYQGOI-RWWJYAHQSA-L |
| XLogP | -0.25 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.71 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate?
The IUPAC name of zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate (CID 139063984) is zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate.
What is the SMILES notation for zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate?
The canonical SMILES for zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate is O=C([O-])C/N=C/c1ccccc1[O-].[Zn+2].c1c[nH]cn1.c1c[nH]cn1.
What is the InChIKey of zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate?
The InChIKey is LGWNYSIMZYQGOI-RWWJYAHQSA-L. The full InChI is InChI=1S/C9H9NO3.2C3H4N2.Zn/c11-8-4-2-1-3-7(8)5-10-6-9(12)13;2*1-2-5-3-4-1;/h1-5,11H,6H2,(H,12,13);2*1-3H,(H,4,5);/q;;;+2/p-2/b10-5+;;;.
What are the key properties of zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate?
zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate has a molecular weight of 378.71 g/mol, XLogP of -0.25, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;bis(1H-imidazole);2-[(2-oxidophenyl)methylideneamino]acetate is sourced from PubChem (CID 139063984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).