C13H15ClKNO3Pt — CID 57341344
potassium;chloroplatinum(1+);(2S)-4-methyl-2-[(2-oxidophenyl)methylideneamino]pentanoate (PubChem CID 57341344) has the molecular formula C13H15ClKNO3Pt and a molecular weight of 502.90 g/mol. Its IUPAC name is potassium;chloroplatinum(1+);(2S)-4-methyl-2-[(2-oxidophenyl)methylideneamino]pentanoate.
| Compound Name | potassium;chloroplatinum(1+);(2S)-4-methyl-2-[(2-oxidophenyl)methylideneamino]pentanoate |
|---|---|
| PubChem CID | 57341344 |
| Molecular Formula | C13H15ClKNO3Pt |
| Molecular Weight | 502.90 g/mol |
| Exact Mass | 502.00 |
| IUPAC Name | potassium;chloroplatinum(1+);(2S)-4-methyl-2-[(2-oxidophenyl)methylideneamino]pentanoate |
| SMILES | CC(C)C[C@H](/N=C/c1ccccc1[O-])C(=O)[O-].Cl[Pt+].[K+] |
| InChI | InChI=1S/C13H17NO3.ClH.K.Pt/c1-9(2)7-11(13(16)17)14-8-10-5-3-4-6-12(10)15;;;/h3-6,8-9,11,15H,7H2,1-2H3,(H,16,17);1H;;/q;;+1;+2/p-3/b14-8+;;;/t11-;;;/m0.../s1 |
| InChIKey | WWTYJYYLANANKC-GCSZCBLPSA-K |
| XLogP | -1.97 |
| TPSA | 75.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.90 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|