C13H15Cl2NO3 — CID 136740401
(2S)-2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4-methylpentanoic acid (PubChem CID 136740401) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is (2S)-2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 136740401 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | (2S)-2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](/N=C/c1cc(Cl)cc(Cl)c1O)C(=O)O |
| InChI | InChI=1S/C13H15Cl2NO3/c1-7(2)3-11(13(18)19)16-6-8-4-9(14)5-10(15)12(8)17/h4-7,11,17H,3H2,1-2H3,(H,18,19)/b16-6+/t11-/m0/s1 |
| InChIKey | NRTUUXUONBMCFN-MTTUFYGSSA-N |
| XLogP | 3.62 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|