C10H10N5OS2+ — CID 135650399
[(E)-(2-oxo-4-pyridin-1-ium-1-yl-3H-1,3-thiazol-5-yl)methylideneamino]thiourea (PubChem CID 135650399) has the molecular formula C10H10N5OS2+ and a molecular weight of 280.36 g/mol. Its IUPAC name is [(E)-(2-oxo-4-pyridin-1-ium-1-yl-3H-1,3-thiazol-5-yl)methylideneamino]thiourea.
| Compound Name | [(E)-(2-oxo-4-pyridin-1-ium-1-yl-3H-1,3-thiazol-5-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 135650399 |
| Molecular Formula | C10H10N5OS2+ |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | [(E)-(2-oxo-4-pyridin-1-ium-1-yl-3H-1,3-thiazol-5-yl)methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C/c1sc(=O)[nH]c1-[n+]1ccccc1 |
| InChI | InChI=1S/C10H9N5OS2/c11-9(17)14-12-6-7-8(13-10(16)18-7)15-4-2-1-3-5-15/h1-6H,(H3-,11,12,13,14,16,17)/p+1 |
| InChIKey | ZYILVJHAEQEOHH-UHFFFAOYSA-O |
| XLogP | -0.12 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|