C16H14N5OS2+ — CID 3820221
1-[(2-oxo-4-pyridin-1-ium-1-yl-3H-1,3-thiazol-5-yl)methylideneamino]-3-phenylthiourea (PubChem CID 3820221) has the molecular formula C16H14N5OS2+ and a molecular weight of 356.46 g/mol. Its IUPAC name is 1-[(2-oxo-4-pyridin-1-ium-1-yl-3H-1,3-thiazol-5-yl)methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(2-oxo-4-pyridin-1-ium-1-yl-3H-1,3-thiazol-5-yl)methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 3820221 |
| Molecular Formula | C16H14N5OS2+ |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 1-[(2-oxo-4-pyridin-1-ium-1-yl-3H-1,3-thiazol-5-yl)methylideneamino]-3-phenylthiourea |
| SMILES | O=c1[nH]c(-[n+]2ccccc2)c(C=NNC(=S)Nc2ccccc2)s1 |
| InChI | InChI=1S/C16H13N5OS2/c22-16-19-14(21-9-5-2-6-10-21)13(24-16)11-17-20-15(23)18-12-7-3-1-4-8-12/h1-11H,(H2-,17,18,19,20,22,23)/p+1 |
| InChIKey | WMOKSXMMLSWEIA-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|