C24H22N5O3S+ — CID 135635695
N-[(E)-[4-[4-[4-(dimethylamino)phenyl]pyridin-1-ium-1-yl]-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]-2-hydroxybenzamide (PubChem CID 135635695) has the molecular formula C24H22N5O3S+ and a molecular weight of 460.54 g/mol. Its IUPAC name is N-[(E)-[4-[4-[4-(dimethylamino)phenyl]pyridin-1-ium-1-yl]-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]-2-hydroxybenzamide.
| Compound Name | N-[(E)-[4-[4-[4-(dimethylamino)phenyl]pyridin-1-ium-1-yl]-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 135635695 |
| Molecular Formula | C24H22N5O3S+ |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | N-[(E)-[4-[4-[4-(dimethylamino)phenyl]pyridin-1-ium-1-yl]-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]-2-hydroxybenzamide |
| SMILES | CN(C)c1ccc(-c2cc[n+](-c3[nH]c(=O)sc3/C=N/NC(=O)c3ccccc3O)cc2)cc1 |
| InChI | InChI=1S/C24H21N5O3S/c1-28(2)18-9-7-16(8-10-18)17-11-13-29(14-12-17)22-21(33-24(32)26-22)15-25-27-23(31)19-5-3-4-6-20(19)30/h3-15H,1-2H3,(H2-,25,26,27,30,31,32)/p+1 |
| InChIKey | FAHAWABFMOAJPB-UHFFFAOYSA-O |
| XLogP | 2.92 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|