C16H18N4O3S — CID 177470196
N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-sulfamoylbenzamide (PubChem CID 177470196) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-sulfamoylbenzamide.
| Compound Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-sulfamoylbenzamide |
|---|---|
| PubChem CID | 177470196 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-sulfamoylbenzamide |
| SMILES | CN(C)c1ccc(/C=N/NC(=O)c2ccccc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H18N4O3S/c1-20(2)13-9-7-12(8-10-13)11-18-19-16(21)14-5-3-4-6-15(14)24(17,22)23/h3-11H,1-2H3,(H,19,21)(H2,17,22,23)/b18-11+ |
| InChIKey | RJSDLXIEJVCZSN-WOJGMQOQSA-N |
| XLogP | 1.16 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|