C23H18N4O2S — CID 135537267
N-[[4-(3-benzylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylidene]benzenecarbohydrazonate (PubChem CID 135537267) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is N-[[4-(3-benzylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylidene]benzenecarbohydrazonate.
| Compound Name | N-[[4-(3-benzylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylidene]benzenecarbohydrazonate |
|---|---|
| PubChem CID | 135537267 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[[4-(3-benzylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylidene]benzenecarbohydrazonate |
| SMILES | O=c1[nH]c(-[n+]2cccc(Cc3ccccc3)c2)c(C=NN=C([O-])c2ccccc2)s1 |
| InChI | InChI=1S/C23H18N4O2S/c28-22(19-11-5-2-6-12-19)26-24-15-20-21(25-23(29)30-20)27-13-7-10-18(16-27)14-17-8-3-1-4-9-17/h1-13,15-16H,14H2,(H-,24,25,26,28,29) |
| InChIKey | QUGQFOZXCUJRAT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|