C17H27N3OS — CID 135653042
4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-1-(6-methylheptan-2-yl)-2H-pyrrol-3-ol (PubChem CID 135653042) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is 4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-1-(6-methylheptan-2-yl)-2H-pyrrol-3-ol.
| Compound Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-1-(6-methylheptan-2-yl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135653042 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-5-imino-1-(6-methylheptan-2-yl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(C)c(C)s2)=C(O)CN1C(C)CCCC(C)C |
| InChI | InChI=1S/C17H27N3OS/c1-10(2)7-6-8-11(3)20-9-14(21)15(16(20)18)17-19-12(4)13(5)22-17/h10-11,18,21H,6-9H2,1-5H3/b18-16- |
| InChIKey | GHGWIQHHJVYNSY-VLGSPTGOSA-N |
| XLogP | 4.54 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|