C16H24N4OS — CID 135653479
4-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[(1-ethylpyrrolidin-2-yl)methyl]-5-imino-2H-pyrrol-3-ol (PubChem CID 135653479) has the molecular formula C16H24N4OS and a molecular weight of 320.46 g/mol. Its IUPAC name is 4-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[(1-ethylpyrrolidin-2-yl)methyl]-5-imino-2H-pyrrol-3-ol.
| Compound Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[(1-ethylpyrrolidin-2-yl)methyl]-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135653479 |
| Molecular Formula | C16H24N4OS |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[(1-ethylpyrrolidin-2-yl)methyl]-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(C)c(C)s2)=C(O)CN1CC1CCCN1CC |
| InChI | InChI=1S/C16H24N4OS/c1-4-19-7-5-6-12(19)8-20-9-13(21)14(15(20)17)16-18-10(2)11(3)22-16/h12,17,21H,4-9H2,1-3H3/b17-15- |
| InChIKey | FAURLBWQCVROTF-ICFOKQHNSA-N |
| XLogP | 2.81 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|