C34H39N5O3 — CID 135662045
7-[4-[(4-tert-butylphenyl)methoxy]-3-ethoxyphenyl]-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135662045) has the molecular formula C34H39N5O3 and a molecular weight of 565.72 g/mol. Its IUPAC name is 7-[4-[(4-tert-butylphenyl)methoxy]-3-ethoxyphenyl]-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-[4-[(4-tert-butylphenyl)methoxy]-3-ethoxyphenyl]-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135662045 |
| Molecular Formula | C34H39N5O3 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | 7-[4-[(4-tert-butylphenyl)methoxy]-3-ethoxyphenyl]-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCOc1cc(C2C(C(=O)Nc3cccc(C)c3C)=C(C)Nc3ncnn32)ccc1OCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C34H39N5O3/c1-8-41-29-18-25(14-17-28(29)42-19-24-12-15-26(16-13-24)34(5,6)7)31-30(23(4)37-33-35-20-36-39(31)33)32(40)38-27-11-9-10-21(2)22(27)3/h9-18,20,31H,8,19H2,1-7H3,(H,38,40)(H,35,36,37) |
| InChIKey | HPOUKBYMCBAAJG-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |