C12H11Cl2N3 — CID 135675922
3,4-dichloro-N-[(E)-1-(1H-pyrrol-2-yl)ethylideneamino]aniline (PubChem CID 135675922) has the molecular formula C12H11Cl2N3 and a molecular weight of 268.15 g/mol. Its IUPAC name is 3,4-dichloro-N-[(E)-1-(1H-pyrrol-2-yl)ethylideneamino]aniline.
| Compound Name | 3,4-dichloro-N-[(E)-1-(1H-pyrrol-2-yl)ethylideneamino]aniline |
|---|---|
| PubChem CID | 135675922 |
| Molecular Formula | C12H11Cl2N3 |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 3,4-dichloro-N-[(E)-1-(1H-pyrrol-2-yl)ethylideneamino]aniline |
| SMILES | C/C(=N\Nc1ccc(Cl)c(Cl)c1)c1ccc[nH]1 |
| InChI | InChI=1S/C12H11Cl2N3/c1-8(12-3-2-6-15-12)16-17-9-4-5-10(13)11(14)7-9/h2-7,15,17H,1H3/b16-8+ |
| InChIKey | BUQDBRYFNAADCQ-LZYBPNLTSA-N |
| XLogP | 4.16 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|