C14H8N4O3S — CID 135678997
(2Z)-2-(4-methyl-1,3-thiazol-2-yl)-2-(5-nitro-2-oxo-1H-indol-3-ylidene)acetonitrile (PubChem CID 135678997) has the molecular formula C14H8N4O3S and a molecular weight of 312.31 g/mol. Its IUPAC name is (2Z)-2-(4-methyl-1,3-thiazol-2-yl)-2-(5-nitro-2-oxo-1H-indol-3-ylidene)acetonitrile.
| Compound Name | (2Z)-2-(4-methyl-1,3-thiazol-2-yl)-2-(5-nitro-2-oxo-1H-indol-3-ylidene)acetonitrile |
|---|---|
| PubChem CID | 135678997 |
| Molecular Formula | C14H8N4O3S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | (2Z)-2-(4-methyl-1,3-thiazol-2-yl)-2-(5-nitro-2-oxo-1H-indol-3-ylidene)acetonitrile |
| SMILES | Cc1csc(/C(C#N)=C2\C(=O)Nc3ccc([N+](=O)[O-])cc32)n1 |
| InChI | InChI=1S/C14H8N4O3S/c1-7-6-22-14(16-7)10(5-15)12-9-4-8(18(20)21)2-3-11(9)17-13(12)19/h2-4,6H,1H3,(H,17,19)/b12-10- |
| InChIKey | YGSIHEGFVOAPGH-BENRWUELSA-N |
| XLogP | 2.75 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|