C19H9ClN4O3S — CID 3335892
2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-(5-nitro-2-oxo-1H-indol-3-ylidene)acetonitrile (PubChem CID 3335892) has the molecular formula C19H9ClN4O3S and a molecular weight of 408.83 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-(5-nitro-2-oxo-1H-indol-3-ylidene)acetonitrile.
| Compound Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-(5-nitro-2-oxo-1H-indol-3-ylidene)acetonitrile |
|---|---|
| PubChem CID | 3335892 |
| Molecular Formula | C19H9ClN4O3S |
| Molecular Weight | 408.83 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-(5-nitro-2-oxo-1H-indol-3-ylidene)acetonitrile |
| SMILES | N#CC(=C1C(=O)Nc2ccc([N+](=O)[O-])cc21)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C19H9ClN4O3S/c20-11-3-1-10(2-4-11)16-9-28-19(23-16)14(8-21)17-13-7-12(24(26)27)5-6-15(13)22-18(17)25/h1-7,9H,(H,22,25) |
| InChIKey | OJDBJIBOJQPMAV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.83 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|