C19H10ClF2N3O3S — CID 75409033
(Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[2-(difluoromethoxy)-5-nitrophenyl]prop-2-enenitrile (PubChem CID 75409033) has the molecular formula C19H10ClF2N3O3S and a molecular weight of 433.82 g/mol. Its IUPAC name is (Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[2-(difluoromethoxy)-5-nitrophenyl]prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[2-(difluoromethoxy)-5-nitrophenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 75409033 |
| Molecular Formula | C19H10ClF2N3O3S |
| Molecular Weight | 433.82 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | (Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[2-(difluoromethoxy)-5-nitrophenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cc([N+](=O)[O-])ccc1OC(F)F)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C19H10ClF2N3O3S/c20-14-3-1-11(2-4-14)16-10-29-18(24-16)13(9-23)7-12-8-15(25(26)27)5-6-17(12)28-19(21)22/h1-8,10,19H/b13-7- |
| InChIKey | NTLRNOSPVUHVIR-QPEQYQDCSA-N |
| XLogP | 6.04 |
| TPSA | 89.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.82 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|