C20H12F4N2O2S — CID 46806855
(E)-3-[2,4-bis(difluoromethoxy)phenyl]-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 46806855) has the molecular formula C20H12F4N2O2S and a molecular weight of 420.39 g/mol. Its IUPAC name is (E)-3-[2,4-bis(difluoromethoxy)phenyl]-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 46806855 |
| Molecular Formula | C20H12F4N2O2S |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(OC(F)F)cc1OC(F)F)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C20H12F4N2O2S/c21-19(22)27-15-7-6-13(17(9-15)28-20(23)24)8-14(10-25)18-26-16(11-29-18)12-4-2-1-3-5-12/h1-9,11,19-20H/b14-8+ |
| InChIKey | DHENHGFCXYUATQ-RIYZIHGNSA-N |
| XLogP | 6.08 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|