C32H28BrClF3N5O4 — CID 135680206
(5S,7R)-5-(4-bromophenyl)-N-[3-(4-chloro-2-cyclohexylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 135680206) has the molecular formula C32H28BrClF3N5O4 and a molecular weight of 718.96 g/mol. Its IUPAC name is (5S,7R)-5-(4-bromophenyl)-N-[3-(4-chloro-2-cyclohexylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5S,7R)-5-(4-bromophenyl)-N-[3-(4-chloro-2-cyclohexylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 135680206 |
| Molecular Formula | C32H28BrClF3N5O4 |
| Molecular Weight | 718.96 g/mol |
| Exact Mass | 717.10 |
| IUPAC Name | (5S,7R)-5-(4-bromophenyl)-N-[3-(4-chloro-2-cyclohexylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1cc(Oc2ccc(Cl)cc2C2CCCCC2)cc([N+](=O)[O-])c1)c1cc2n(n1)[C@@H](C(F)(F)F)C[C@@H](c1ccc(Br)cc1)N2 |
| InChI | InChI=1S/C32H28BrClF3N5O4/c33-20-8-6-19(7-9-20)26-16-29(32(35,36)37)41-30(39-26)17-27(40-41)31(43)38-22-13-23(42(44)45)15-24(14-22)46-28-11-10-21(34)12-25(28)18-4-2-1-3-5-18/h6-15,17-18,26,29,39H,1-5,16H2,(H,38,43)/t26-,29+/m0/s1 |
| InChIKey | RIYRKPLIAGOZBS-LITSAYRRSA-N |
| XLogP | 9.96 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.96 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|