C24H18N4O2 — CID 135682212
4-(4-methoxyphenyl)-6-oxo-2-(2-phenylanilino)-1H-pyrimidine-5-carbonitrile (PubChem CID 135682212) has the molecular formula C24H18N4O2 and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-6-oxo-2-(2-phenylanilino)-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(4-methoxyphenyl)-6-oxo-2-(2-phenylanilino)-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135682212 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 4-(4-methoxyphenyl)-6-oxo-2-(2-phenylanilino)-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1ccc(-c2nc(Nc3ccccc3-c3ccccc3)[nH]c(=O)c2C#N)cc1 |
| InChI | InChI=1S/C24H18N4O2/c1-30-18-13-11-17(12-14-18)22-20(15-25)23(29)28-24(27-22)26-21-10-6-5-9-19(21)16-7-3-2-4-8-16/h2-14H,1H3,(H2,26,27,28,29) |
| InChIKey | NVGRNRWIQQAUIW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|