C19H14Cl2N4O2 — CID 137301699
2-[(2,4-dichlorophenyl)methylamino]-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 137301699) has the molecular formula C19H14Cl2N4O2 and a molecular weight of 401.25 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylamino]-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[(2,4-dichlorophenyl)methylamino]-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 137301699 |
| Molecular Formula | C19H14Cl2N4O2 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylamino]-4-(4-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1ccc(-c2nc(NCc3ccc(Cl)cc3Cl)[nH]c(=O)c2C#N)cc1 |
| InChI | InChI=1S/C19H14Cl2N4O2/c1-27-14-6-3-11(4-7-14)17-15(9-22)18(26)25-19(24-17)23-10-12-2-5-13(20)8-16(12)21/h2-8H,10H2,1H3,(H2,23,24,25,26) |
| InChIKey | XCBGBJLTYJXOIN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|