C15H12Cl2N6O2S — CID 135689821
5-chloro-4-[(2E)-2-[[4-chloro-2-(4-methoxyanilino)-1,3-thiazol-5-yl]methylidene]hydrazinyl]-1H-pyridazin-6-one (PubChem CID 135689821) has the molecular formula C15H12Cl2N6O2S and a molecular weight of 411.27 g/mol. Its IUPAC name is 5-chloro-4-[(2E)-2-[[4-chloro-2-(4-methoxyanilino)-1,3-thiazol-5-yl]methylidene]hydrazinyl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[(2E)-2-[[4-chloro-2-(4-methoxyanilino)-1,3-thiazol-5-yl]methylidene]hydrazinyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 135689821 |
| Molecular Formula | C15H12Cl2N6O2S |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | 5-chloro-4-[(2E)-2-[[4-chloro-2-(4-methoxyanilino)-1,3-thiazol-5-yl]methylidene]hydrazinyl]-1H-pyridazin-6-one |
| SMILES | COc1ccc(Nc2nc(Cl)c(/C=N/Nc3cn[nH]c(=O)c3Cl)s2)cc1 |
| InChI | InChI=1S/C15H12Cl2N6O2S/c1-25-9-4-2-8(3-5-9)20-15-21-13(17)11(26-15)7-19-22-10-6-18-23-14(24)12(10)16/h2-7H,1H3,(H,20,21)(H2,22,23,24)/b19-7+ |
| InChIKey | WAYFVEIRGNOHIX-FBCYGCLPSA-N |
| XLogP | 3.73 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|