C19H29N5O3S — CID 135689849
N-[4-hydroxy-3-[(E)-C-methyl-N-(2-morpholin-4-ylethylcarbamothioylamino)carbonimidoyl]phenyl]butanamide (PubChem CID 135689849) has the molecular formula C19H29N5O3S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[4-hydroxy-3-[(E)-C-methyl-N-(2-morpholin-4-ylethylcarbamothioylamino)carbonimidoyl]phenyl]butanamide.
| Compound Name | N-[4-hydroxy-3-[(E)-C-methyl-N-(2-morpholin-4-ylethylcarbamothioylamino)carbonimidoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 135689849 |
| Molecular Formula | C19H29N5O3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-[4-hydroxy-3-[(E)-C-methyl-N-(2-morpholin-4-ylethylcarbamothioylamino)carbonimidoyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(O)c(/C(C)=N/NC(=S)NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C19H29N5O3S/c1-3-4-18(26)21-15-5-6-17(25)16(13-15)14(2)22-23-19(28)20-7-8-24-9-11-27-12-10-24/h5-6,13,25H,3-4,7-12H2,1-2H3,(H,21,26)(H2,20,23,28)/b22-14+ |
| InChIKey | PLXFGLVKRIZLLA-HYARGMPZSA-N |
| XLogP | 1.65 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|