C22H18N4O4S — CID 135692926
4-[(1-hydroxynaphthalen-2-yl)methylideneamino]-N-(6-methoxypyrimidin-4-yl)benzenesulfonamide (PubChem CID 135692926) has the molecular formula C22H18N4O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is 4-[(1-hydroxynaphthalen-2-yl)methylideneamino]-N-(6-methoxypyrimidin-4-yl)benzenesulfonamide.
| Compound Name | 4-[(1-hydroxynaphthalen-2-yl)methylideneamino]-N-(6-methoxypyrimidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 135692926 |
| Molecular Formula | C22H18N4O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 4-[(1-hydroxynaphthalen-2-yl)methylideneamino]-N-(6-methoxypyrimidin-4-yl)benzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(/N=C/c3ccc4ccccc4c3O)cc2)ncn1 |
| InChI | InChI=1S/C22H18N4O4S/c1-30-21-12-20(24-14-25-21)26-31(28,29)18-10-8-17(9-11-18)23-13-16-7-6-15-4-2-3-5-19(15)22(16)27/h2-14,27H,1H3,(H,24,25,26)/b23-13+ |
| InChIKey | WZUSHPONQGJLDV-YDZHTSKRSA-N |
| XLogP | 3.90 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|