About [(E)-[(2E,3E)-2-[(2-chlorophenyl)hydrazinylidene]-3-hydroxyiminopropylidene]amino] acetate
[(E)-[(2E,3E)-2-[(2-chlorophenyl)hydrazinylidene]-3-hydroxyiminopropylidene]amino] acetate (PubChem CID 135697323) has the molecular formula C11H11ClN4O3
and a molecular weight of 282.69 g/mol. Its IUPAC name is [(E)-[(2E,3E)-2-[(2-chlorophenyl)hydrazinylidene]-3-hydroxyiminopropylidene]amino] acetate.
Molecular Properties
| Compound Name | [(E)-[(2E,3E)-2-[(2-chlorophenyl)hydrazinylidene]-3-hydroxyiminopropylidene]amino] acetate |
| PubChem CID | 135697323 |
| Molecular Formula | C11H11ClN4O3 |
| Molecular Weight | 282.69 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | [(E)-[(2E,3E)-2-[(2-chlorophenyl)hydrazinylidene]-3-hydroxyiminopropylidene]amino] acetate |
| SMILES | CC(=O)O/N=C/C(/C=N/O)=N/Nc1ccccc1Cl |
| InChI | InChI=1S/C11H11ClN4O3/c1-8(17)19-14-7-9(6-13-18)15-16-11-5-3-2-4-10(11)12/h2-7,16,18H,1H3/b13-6+,14-7+,15-9+ |
| InChIKey | RHDAFBNAGKLZKJ-IIQAIUIJSA-N |
| XLogP | 2.12 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.69 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[(2E,3E)-2-[(2-chlorophenyl)hydrazinylidene]-3-hydroxyiminopropylidene]amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[(2E,3E)-2-[(2-chlorophenyl)hydrazinylidene]-3-hydroxyiminopropylidene]amino] acetate?
The IUPAC name of [(E)-[(2E,3E)-2-[(2-chlorophenyl)hydrazinylidene]-3-hydroxyiminopropylidene]amino] acetate (CID 135697323) is [(E)-[(2E,3E)-2-[(2-chlorophenyl)hydrazinylidene]-3-hydroxyiminopropylidene]amino] acetate.
What is the SMILES notation for [(E)-[(2E,3E)-2-[(2-chlorophenyl)hydrazinylidene]-3-hydroxyiminopropylidene]amino] acetate?
The canonical SMILES for [(E)-[(2E,3E)-2-[(2-chlorophenyl)hydrazinylidene]-3-hydroxyiminopropylidene]amino] acetate is CC(=O)O/N=C/C(/C=N/O)=N/Nc1ccccc1Cl.
What is the InChIKey of [(E)-[(2E,3E)-2-[(2-chlorophenyl)hydrazinylidene]-3-hydroxyiminopropylidene]amino] acetate?
The InChIKey is RHDAFBNAGKLZKJ-IIQAIUIJSA-N. The full InChI is InChI=1S/C11H11ClN4O3/c1-8(17)19-14-7-9(6-13-18)15-16-11-5-3-2-4-10(11)12/h2-7,16,18H,1H3/b13-6+,14-7+,15-9+.
What are the key properties of [(E)-[(2E,3E)-2-[(2-chlorophenyl)hydrazinylidene]-3-hydroxyiminopropylidene]amino] acetate?
[(E)-[(2E,3E)-2-[(2-chlorophenyl)hydrazinylidene]-3-hydroxyiminopropylidene]amino] acetate has a molecular weight of 282.69 g/mol, XLogP of 2.12, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[(2E,3E)-2-[(2-chlorophenyl)hydrazinylidene]-3-hydroxyiminopropylidene]amino] acetate is sourced from PubChem (CID 135697323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).