C22H15Cl2N2O5S- — CID 135697767
2-chloro-5-[[(5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 135697767) has the molecular formula C22H15Cl2N2O5S- and a molecular weight of 490.34 g/mol. Its IUPAC name is 2-chloro-5-[[(5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | 2-chloro-5-[[(5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 135697767 |
| Molecular Formula | C22H15Cl2N2O5S- |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 489.01 |
| IUPAC Name | 2-chloro-5-[[(5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | C#CCOc1c(Cl)cc(/C=C2\S/C(=N/c3ccc(Cl)c(C(=O)[O-])c3)NC2=O)cc1OCC |
| InChI | InChI=1S/C22H16Cl2N2O5S/c1-3-7-31-19-16(24)8-12(9-17(19)30-4-2)10-18-20(27)26-22(32-18)25-13-5-6-15(23)14(11-13)21(28)29/h1,5-6,8-11H,4,7H2,2H3,(H,28,29)(H,25,26,27)/p-1/b18-10- |
| InChIKey | RQHNFQFVYIZYKV-ZDLGFXPLSA-M |
| XLogP | 3.66 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|