C19H16N4O3S — CID 135699828
N-[5-[2-[(2-hydroxyphenyl)methylideneamino]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide (PubChem CID 135699828) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-[5-[2-[(2-hydroxyphenyl)methylideneamino]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide.
| Compound Name | N-[5-[2-[(2-hydroxyphenyl)methylideneamino]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 135699828 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-[5-[2-[(2-hydroxyphenyl)methylideneamino]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1nnc(CC(=O)/N=C/c2ccccc2O)s1 |
| InChI | InChI=1S/C19H16N4O3S/c1-12-6-2-4-8-14(12)18(26)21-19-23-22-17(27-19)10-16(25)20-11-13-7-3-5-9-15(13)24/h2-9,11,24H,10H2,1H3,(H,21,23,26)/b20-11+ |
| InChIKey | AIUKKARMKXBOIE-RGVLZGJSSA-N |
| XLogP | 2.99 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|