C20H18ClN3O5S — CID 135702303
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl (3S)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 135702303) has the molecular formula C20H18ClN3O5S and a molecular weight of 447.90 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl (3S)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl (3S)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 135702303 |
| Molecular Formula | C20H18ClN3O5S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl (3S)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(OCC/N=C1\NS(=O)(=O)c2ccccc21)[C@H]1CC(=O)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H18ClN3O5S/c21-14-5-7-15(8-6-14)24-12-13(11-18(24)25)20(26)29-10-9-22-19-16-3-1-2-4-17(16)30(27,28)23-19/h1-8,13H,9-12H2,(H,22,23)/t13-/m0/s1 |
| InChIKey | UNEIADXOBNBOGV-ZDUSSCGKSA-N |
| XLogP | 1.97 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|