C21H20ClN3O5S — CID 136695704
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl (3R)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 136695704) has the molecular formula C21H20ClN3O5S and a molecular weight of 461.93 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl (3R)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl (3R)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 136695704 |
| Molecular Formula | C21H20ClN3O5S |
| Molecular Weight | 461.93 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl (3R)-1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(OCCC/N=C1\NS(=O)(=O)c2ccccc21)[C@@H]1CC(=O)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C21H20ClN3O5S/c22-15-6-8-16(9-7-15)25-13-14(12-19(25)26)21(27)30-11-3-10-23-20-17-4-1-2-5-18(17)31(28,29)24-20/h1-2,4-9,14H,3,10-13H2,(H,23,24)/t14-/m1/s1 |
| InChIKey | HJUQDFFXJYJXLH-CQSZACIVSA-N |
| XLogP | 2.36 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.93 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|