C22H29NO3S2 — CID 135702395
2-[(Z)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(6,7,8-trimethyl-2,3-dihydro-1,4-benzodithiin-5-yl)cyclohex-2-en-1-one (PubChem CID 135702395) has the molecular formula C22H29NO3S2 and a molecular weight of 419.61 g/mol. Its IUPAC name is 2-[(Z)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(6,7,8-trimethyl-2,3-dihydro-1,4-benzodithiin-5-yl)cyclohex-2-en-1-one.
| Compound Name | 2-[(Z)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(6,7,8-trimethyl-2,3-dihydro-1,4-benzodithiin-5-yl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135702395 |
| Molecular Formula | C22H29NO3S2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 2-[(Z)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(6,7,8-trimethyl-2,3-dihydro-1,4-benzodithiin-5-yl)cyclohex-2-en-1-one |
| SMILES | CCO/N=C(/CC)C1=C(O)CC(c2c(C)c(C)c(C)c3c2SCCS3)CC1=O |
| InChI | InChI=1S/C22H29NO3S2/c1-6-16(23-26-7-2)20-17(24)10-15(11-18(20)25)19-13(4)12(3)14(5)21-22(19)28-9-8-27-21/h15,24H,6-11H2,1-5H3/b23-16- |
| InChIKey | QDELZZNIPBVWDP-KQWNVCNZSA-N |
| XLogP | 5.87 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|