C26H34N2O4 — CID 174599216
3-cyclopropyl-1,2-oxazole;2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one (PubChem CID 174599216) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 3-cyclopropyl-1,2-oxazole;2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one.
| Compound Name | 3-cyclopropyl-1,2-oxazole;2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 174599216 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 3-cyclopropyl-1,2-oxazole;2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one |
| SMILES | CCO/N=C(\CC)C1=C(O)CC(c2c(C)cc(C)cc2C)CC1=O.c1cc(C2CC2)no1 |
| InChI | InChI=1S/C20H27NO3.C6H7NO/c1-6-16(21-24-7-2)20-17(22)10-15(11-18(20)23)19-13(4)8-12(3)9-14(19)5;1-2-5(1)6-3-4-8-7-6/h8-9,15,22H,6-7,10-11H2,1-5H3;3-5H,1-2H2/b21-16+; |
| InChIKey | FUBQJWURUVQKEX-JEBHESKQSA-N |
| XLogP | 6.22 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|