C26H32N4O7 — CID 174796434
2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one;N-nitro-N-phenylnitramide (PubChem CID 174796434) has the molecular formula C26H32N4O7 and a molecular weight of 512.56 g/mol. Its IUPAC name is 2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one;N-nitro-N-phenylnitramide.
| Compound Name | 2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one;N-nitro-N-phenylnitramide |
|---|---|
| PubChem CID | 174796434 |
| Molecular Formula | C26H32N4O7 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one;N-nitro-N-phenylnitramide |
| SMILES | CCO/N=C(\CC)C1=C(O)CC(c2c(C)cc(C)cc2C)CC1=O.O=[N+]([O-])N(c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C20H27NO3.C6H5N3O4/c1-6-16(21-24-7-2)20-17(22)10-15(11-18(20)23)19-13(4)8-12(3)9-14(19)5;10-8(11)7(9(12)13)6-4-2-1-3-5-6/h8-9,15,22H,6-7,10-11H2,1-5H3;1-5H/b21-16+; |
| InChIKey | WRINAERQYZKETA-JEBHESKQSA-N |
| XLogP | 5.55 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|