C24H31N5O3S — CID 135702426
3-N-benzyl-1,1-dioxo-4-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazolidine-3,4-diimine (PubChem CID 135702426) has the molecular formula C24H31N5O3S and a molecular weight of 469.61 g/mol. Its IUPAC name is 3-N-benzyl-1,1-dioxo-4-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazolidine-3,4-diimine.
| Compound Name | 3-N-benzyl-1,1-dioxo-4-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazolidine-3,4-diimine |
|---|---|
| PubChem CID | 135702426 |
| Molecular Formula | C24H31N5O3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 3-N-benzyl-1,1-dioxo-4-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazolidine-3,4-diimine |
| SMILES | O=S1(=O)NC(=N\Cc2ccccc2)/C(=N\CCCOc2cccc(CN3CCCCC3)c2)N1 |
| InChI | InChI=1S/C24H31N5O3S/c30-33(31)27-23(24(28-33)26-18-20-9-3-1-4-10-20)25-13-8-16-32-22-12-7-11-21(17-22)19-29-14-5-2-6-15-29/h1,3-4,7,9-12,17H,2,5-6,8,13-16,18-19H2,(H,25,27)(H,26,28) |
| InChIKey | HLMNFOMBJLBYKP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|