C23H30N6O2S — CID 173393921
1-oxido-4-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-3-N-(pyridin-2-ylmethyl)-1,2,5-thiadiazolidin-1-ium-3,4-diimine (PubChem CID 173393921) has the molecular formula C23H30N6O2S and a molecular weight of 454.60 g/mol. Its IUPAC name is 1-oxido-4-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-3-N-(pyridin-2-ylmethyl)-1,2,5-thiadiazolidin-1-ium-3,4-diimine.
| Compound Name | 1-oxido-4-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-3-N-(pyridin-2-ylmethyl)-1,2,5-thiadiazolidin-1-ium-3,4-diimine |
|---|---|
| PubChem CID | 173393921 |
| Molecular Formula | C23H30N6O2S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 1-oxido-4-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-3-N-(pyridin-2-ylmethyl)-1,2,5-thiadiazolidin-1-ium-3,4-diimine |
| SMILES | [O-][s+]1[nH]c(=N\CCCOc2cccc(CN3CCCCC3)c2)/c(=N/Cc2ccccn2)[nH]1 |
| InChI | InChI=1S/C23H30N6O2S/c30-32-27-22(23(28-32)26-17-20-9-2-3-11-24-20)25-12-7-15-31-21-10-6-8-19(16-21)18-29-13-4-1-5-14-29/h2-3,6,8-11,16H,1,4-5,7,12-15,17-18H2,(H,25,27)(H,26,28) |
| InChIKey | KEOFHLLJASQRTJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|