C26H30N4O3 — CID 173386714
3-[4-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enylamino]-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 173386714) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is 3-[4-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enylamino]-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[4-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enylamino]-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 173386714 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 3-[4-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enylamino]-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCC=CCOc2cccc(CN3CCCCC3)c2)c(NCc2ccccn2)c1=O |
| InChI | InChI=1S/C26H30N4O3/c31-25-23(24(26(25)32)29-18-21-10-2-3-12-27-21)28-13-4-7-16-33-22-11-8-9-20(17-22)19-30-14-5-1-6-15-30/h2-4,7-12,17,28-29H,1,5-6,13-16,18-19H2 |
| InChIKey | BJYXTHRAABMYLW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|