C19H27N5O — CID 88595809
2-cyano-1-methyl-1-[(Z)-4-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]guanidine (PubChem CID 88595809) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 2-cyano-1-methyl-1-[(Z)-4-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]guanidine.
| Compound Name | 2-cyano-1-methyl-1-[(Z)-4-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]guanidine |
|---|---|
| PubChem CID | 88595809 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 2-cyano-1-methyl-1-[(Z)-4-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]guanidine |
| SMILES | CN(C/C=C\COc1cccc(CN2CCCCC2)c1)/C(N)=N/C#N |
| InChI | InChI=1S/C19H27N5O/c1-23(19(21)22-16-20)10-5-6-13-25-18-9-7-8-17(14-18)15-24-11-3-2-4-12-24/h5-9,14H,2-4,10-13,15H2,1H3,(H2,21,22)/b6-5- |
| InChIKey | MYPORPXBYAUDSF-WAYWQWQTSA-N |
| XLogP | 2.34 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|