C26H32N4O3S — CID 135706437
N-(1-benzylpiperidin-4-yl)-2-[[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-ylidene]amino]acetamide (PubChem CID 135706437) has the molecular formula C26H32N4O3S and a molecular weight of 480.63 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-[[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-ylidene]amino]acetamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-[[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-ylidene]amino]acetamide |
|---|---|
| PubChem CID | 135706437 |
| Molecular Formula | C26H32N4O3S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-[[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-ylidene]amino]acetamide |
| SMILES | CCC1=C(c2ccc(C)cc2)S(=O)(=O)N/C1=N\CC(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H32N4O3S/c1-3-23-25(21-11-9-19(2)10-12-21)34(32,33)29-26(23)27-17-24(31)28-22-13-15-30(16-14-22)18-20-7-5-4-6-8-20/h4-12,22H,3,13-18H2,1-2H3,(H,27,29)(H,28,31) |
| InChIKey | WRCJXRGTNAISEG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|