C22H25N3O2S — CID 135810120
N-(1-benzylpiperidin-4-yl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-imine (PubChem CID 135810120) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-imine.
| Compound Name | N-(1-benzylpiperidin-4-yl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-imine |
|---|---|
| PubChem CID | 135810120 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-imine |
| SMILES | CC1=C(c2ccccc2)S(=O)(=O)N/C1=N/C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H25N3O2S/c1-17-21(19-10-6-3-7-11-19)28(26,27)24-22(17)23-20-12-14-25(15-13-20)16-18-8-4-2-5-9-18/h2-11,20H,12-16H2,1H3,(H,23,24) |
| InChIKey | IYYUTUJFXQCIQK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|