C21H24N4O3S — CID 135939870
N-[(3S)-1-benzylpiperidin-3-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide (PubChem CID 135939870) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is N-[(3S)-1-benzylpiperidin-3-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide.
| Compound Name | N-[(3S)-1-benzylpiperidin-3-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 135939870 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[(3S)-1-benzylpiperidin-3-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide |
| SMILES | O=C(C/N=C1\NS(=O)(=O)c2ccccc21)N[C@H]1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H24N4O3S/c26-20(13-22-21-18-10-4-5-11-19(18)29(27,28)24-21)23-17-9-6-12-25(15-17)14-16-7-2-1-3-8-16/h1-5,7-8,10-11,17H,6,9,12-15H2,(H,22,24)(H,23,26)/t17-/m0/s1 |
| InChIKey | QEEDJFCLGZMQAW-KRWDZBQOSA-N |
| XLogP | 1.51 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|