C23H30O6 — CID 135707704
[(2R,4S,11R)-2-acetyloxy-5,5-dimethyl-14-methylidene-10,15-dioxo-11-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate (PubChem CID 135707704) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is [(2R,4S,11R)-2-acetyloxy-5,5-dimethyl-14-methylidene-10,15-dioxo-11-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate.
| Compound Name | [(2R,4S,11R)-2-acetyloxy-5,5-dimethyl-14-methylidene-10,15-dioxo-11-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate |
|---|---|
| PubChem CID | 135707704 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [(2R,4S,11R)-2-acetyloxy-5,5-dimethyl-14-methylidene-10,15-dioxo-11-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate |
| SMILES | C=C1C(=O)C2=CC1C[C@@H](OC(C)=O)C(=O)C1CCCC(C)(C)[C@H]1C[C@H]2OC(C)=O |
| InChI | InChI=1S/C23H30O6/c1-12-15-9-17(21(12)26)19(28-13(2)24)11-18-16(7-6-8-23(18,4)5)22(27)20(10-15)29-14(3)25/h9,15-16,18-20H,1,6-8,10-11H2,2-5H3/t15?,16?,18-,19+,20+/m0/s1 |
| InChIKey | KEQXOUOSUPOFJG-SSYYCLFMSA-N |
| XLogP | 3.34 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|