C21H28O5 — CID 135707705
[(2R,4S,11R)-2-hydroxy-5,5-dimethyl-14-methylidene-10,15-dioxo-11-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate (PubChem CID 135707705) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is [(2R,4S,11R)-2-hydroxy-5,5-dimethyl-14-methylidene-10,15-dioxo-11-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate.
| Compound Name | [(2R,4S,11R)-2-hydroxy-5,5-dimethyl-14-methylidene-10,15-dioxo-11-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate |
|---|---|
| PubChem CID | 135707705 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | [(2R,4S,11R)-2-hydroxy-5,5-dimethyl-14-methylidene-10,15-dioxo-11-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] acetate |
| SMILES | C=C1C(=O)C2=CC1C[C@@H](OC(C)=O)C(=O)C1CCCC(C)(C)[C@H]1C[C@H]2O |
| InChI | InChI=1S/C21H28O5/c1-11-13-8-15(19(11)24)17(23)10-16-14(6-5-7-21(16,3)4)20(25)18(9-13)26-12(2)22/h8,13-14,16-18,23H,1,5-7,9-10H2,2-4H3/t13?,14?,16-,17+,18+/m0/s1 |
| InChIKey | LECNWPFYEGKMGB-ZTEIYONCSA-N |
| XLogP | 2.77 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|