C22H27ClO5 — CID 166625824
[(2R,4R,9R,13R)-5,5,9-trimethyl-14-methylidene-8,10,15-trioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] 2-chloroacetate (PubChem CID 166625824) has the molecular formula C22H27ClO5 and a molecular weight of 406.91 g/mol. Its IUPAC name is [(2R,4R,9R,13R)-5,5,9-trimethyl-14-methylidene-8,10,15-trioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] 2-chloroacetate.
| Compound Name | [(2R,4R,9R,13R)-5,5,9-trimethyl-14-methylidene-8,10,15-trioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] 2-chloroacetate |
|---|---|
| PubChem CID | 166625824 |
| Molecular Formula | C22H27ClO5 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | [(2R,4R,9R,13R)-5,5,9-trimethyl-14-methylidene-8,10,15-trioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] 2-chloroacetate |
| SMILES | C=C1C(=O)C2=C[C@H]1CCC(=O)[C@]1(C)C(=O)CCC(C)(C)[C@H]1C[C@H]2OC(=O)CCl |
| InChI | InChI=1S/C22H27ClO5/c1-12-13-5-6-17(24)22(4)16(21(2,3)8-7-18(22)25)10-15(28-19(26)11-23)14(9-13)20(12)27/h9,13,15-16H,1,5-8,10-11H2,2-4H3/t13-,15-,16-,22-/m1/s1 |
| InChIKey | SZRHCLXIMIFVLA-GRIISVOLSA-N |
| XLogP | 3.58 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|