C24H31ClO6 — CID 166628230
[(2R,4R,8R,9S,13R)-8-acetyloxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] 2-chloroacetate (PubChem CID 166628230) has the molecular formula C24H31ClO6 and a molecular weight of 450.96 g/mol. Its IUPAC name is [(2R,4R,8R,9S,13R)-8-acetyloxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] 2-chloroacetate.
| Compound Name | [(2R,4R,8R,9S,13R)-8-acetyloxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] 2-chloroacetate |
|---|---|
| PubChem CID | 166628230 |
| Molecular Formula | C24H31ClO6 |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | [(2R,4R,8R,9S,13R)-8-acetyloxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] 2-chloroacetate |
| SMILES | C=C1C(=O)C2=C[C@H]1CCC(=O)[C@@]1(C)[C@H](C[C@H]2OC(=O)CCl)C(C)(C)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H31ClO6/c1-13-15-6-7-19(27)24(5)18(23(3,4)9-8-20(24)30-14(2)26)11-17(31-21(28)12-25)16(10-15)22(13)29/h10,15,17-18,20H,1,6-9,11-12H2,2-5H3/t15-,17-,18-,20-,24-/m1/s1 |
| InChIKey | VXLGDIOGKPLSSF-VEIYPLLESA-N |
| XLogP | 3.95 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|