C18H27NO3Si — CID 135717552
3-[(2R,3R)-3-[dimethyl(phenyl)silyl]-2,4-dimethylpentanoyl]-1,3-oxazolidin-2-one (PubChem CID 135717552) has the molecular formula C18H27NO3Si and a molecular weight of 333.50 g/mol. Its IUPAC name is 3-[(2R,3R)-3-[dimethyl(phenyl)silyl]-2,4-dimethylpentanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(2R,3R)-3-[dimethyl(phenyl)silyl]-2,4-dimethylpentanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135717552 |
| Molecular Formula | C18H27NO3Si |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 3-[(2R,3R)-3-[dimethyl(phenyl)silyl]-2,4-dimethylpentanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H]([C@H](C)C(=O)N1CCOC1=O)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H27NO3Si/c1-13(2)16(23(4,5)15-9-7-6-8-10-15)14(3)17(20)19-11-12-22-18(19)21/h6-10,13-14,16H,11-12H2,1-5H3/t14-,16+/m0/s1 |
| InChIKey | ZEKBECSNDCCLOL-GOEBONIOSA-N |
| XLogP | 3.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|